About 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine
4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine (PubChem CID 135246529) has the molecular formula C12H10F2IN3O2
and a molecular weight of 393.13 g/mol. Its IUPAC name is 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine.
Molecular Properties
| Compound Name | 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine |
| PubChem CID | 135246529 |
| Molecular Formula | C12H10F2IN3O2 |
| Molecular Weight | 393.13 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine |
| SMILES | COCC(F)(F)c1ccc(Oc2ncncc2I)cn1 |
| InChI | InChI=1S/C12H10F2IN3O2/c1-19-6-12(13,14)10-3-2-8(4-17-10)20-11-9(15)5-16-7-18-11/h2-5,7H,6H2,1H3 |
| InChIKey | DIJOQGPMJNBJFX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.13 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine?
The IUPAC name of 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine (CID 135246529) is 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine.
What is the SMILES notation for 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine?
The canonical SMILES for 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine is COCC(F)(F)c1ccc(Oc2ncncc2I)cn1.
What is the InChIKey of 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine?
The InChIKey is DIJOQGPMJNBJFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2IN3O2/c1-19-6-12(13,14)10-3-2-8(4-17-10)20-11-9(15)5-16-7-18-11/h2-5,7H,6H2,1H3.
What are the key properties of 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine?
4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine has a molecular weight of 393.13 g/mol, XLogP of 3.01, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[6-(1,1-difluoro-2-methoxyethyl)-3-pyridinyl]oxy]-5-iodopyrimidine is sourced from PubChem (CID 135246529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).