About 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine
2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine (PubChem CID 135246532) has the molecular formula C19H17F2N3O
and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine.
Molecular Properties
| Compound Name | 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine |
| PubChem CID | 135246532 |
| Molecular Formula | C19H17F2N3O |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine |
| SMILES | CCc1cccc(-c2cccnc2Oc2ccc(C(C)(F)F)nc2)n1 |
| InChI | InChI=1S/C19H17F2N3O/c1-3-13-6-4-8-16(24-13)15-7-5-11-22-18(15)25-14-9-10-17(23-12-14)19(2,20)21/h4-12H,3H2,1-2H3 |
| InChIKey | GZYHRQMUKYDYHC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine?
The IUPAC name of 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine (CID 135246532) is 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine.
What is the SMILES notation for 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine?
The canonical SMILES for 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine is CCc1cccc(-c2cccnc2Oc2ccc(C(C)(F)F)nc2)n1.
What is the InChIKey of 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine?
The InChIKey is GZYHRQMUKYDYHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F2N3O/c1-3-13-6-4-8-16(24-13)15-7-5-11-22-18(15)25-14-9-10-17(23-12-14)19(2,20)21/h4-12H,3H2,1-2H3.
What are the key properties of 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine?
2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine has a molecular weight of 341.36 g/mol, XLogP of 5.01, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroethyl)-5-[[3-(6-ethyl-2-pyridinyl)-2-pyridinyl]oxy]pyridine is sourced from PubChem (CID 135246532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).