C22H19F2N3O — CID 135246603
N-[(3Z,5E)-2,2-difluoro-6-[(3-isoquinolin-4-yl-2-pyridinyl)oxy]hepta-3,5-dien-3-yl]methanimine (PubChem CID 135246603) has the molecular formula C22H19F2N3O and a molecular weight of 379.41 g/mol. Its IUPAC name is N-[(3Z,5E)-2,2-difluoro-6-[(3-isoquinolin-4-yl-2-pyridinyl)oxy]hepta-3,5-dien-3-yl]methanimine.
| Compound Name | N-[(3Z,5E)-2,2-difluoro-6-[(3-isoquinolin-4-yl-2-pyridinyl)oxy]hepta-3,5-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 135246603 |
| Molecular Formula | C22H19F2N3O |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[(3Z,5E)-2,2-difluoro-6-[(3-isoquinolin-4-yl-2-pyridinyl)oxy]hepta-3,5-dien-3-yl]methanimine |
| SMILES | C=N/C(=C\C=C(/C)Oc1ncccc1-c1cncc2ccccc12)C(C)(F)F |
| InChI | InChI=1S/C22H19F2N3O/c1-15(10-11-20(25-3)22(2,23)24)28-21-18(9-6-12-27-21)19-14-26-13-16-7-4-5-8-17(16)19/h4-14H,3H2,1-2H3/b15-10+,20-11- |
| InChIKey | PCWTVSPORXOSTD-MBOPZJHMSA-N |
| XLogP | 5.82 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|