About ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate
ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate (PubChem CID 135247047) has the molecular formula C11H18O3S
and a molecular weight of 230.33 g/mol. Its IUPAC name is ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate.
Molecular Properties
| Compound Name | ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate |
| PubChem CID | 135247047 |
| Molecular Formula | C11H18O3S |
| Molecular Weight | 230.33 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate |
| SMILES | CCOS(=O)(=O)C1C=CC(C(C)C)=CC1 |
| InChI | InChI=1S/C11H18O3S/c1-4-14-15(12,13)11-7-5-10(6-8-11)9(2)3/h5-7,9,11H,4,8H2,1-3H3 |
| InChIKey | OHEREQQGTJGFHN-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate?
The IUPAC name of ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate (CID 135247047) is ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate.
What is the SMILES notation for ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate?
The canonical SMILES for ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate is CCOS(=O)(=O)C1C=CC(C(C)C)=CC1.
What is the InChIKey of ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate?
The InChIKey is OHEREQQGTJGFHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O3S/c1-4-14-15(12,13)11-7-5-10(6-8-11)9(2)3/h5-7,9,11H,4,8H2,1-3H3.
What are the key properties of ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate?
ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate has a molecular weight of 230.33 g/mol, XLogP of 2.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-propan-2-ylcyclohexa-2,4-diene-1-sulfonate is sourced from PubChem (CID 135247047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).