C38H27F2N3 — CID 135247059
2-[6-[2-[(1Z)-buta-1,3-dienyl]phenyl]-9,9-difluorofluoren-3-yl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 135247059) has the molecular formula C38H27F2N3 and a molecular weight of 563.65 g/mol. Its IUPAC name is 2-[6-[2-[(1Z)-buta-1,3-dienyl]phenyl]-9,9-difluorofluoren-3-yl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-[6-[2-[(1Z)-buta-1,3-dienyl]phenyl]-9,9-difluorofluoren-3-yl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 135247059 |
| Molecular Formula | C38H27F2N3 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 2-[6-[2-[(1Z)-buta-1,3-dienyl]phenyl]-9,9-difluorofluoren-3-yl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | C=C/C=C\c1ccccc1-c1ccc2c(c1)-c1cc(C3=NC(c4ccccc4)N=C(c4ccccc4)N3)ccc1C2(F)F |
| InChI | InChI=1S/C38H27F2N3/c1-2-3-12-25-13-10-11-18-30(25)28-19-21-33-31(23-28)32-24-29(20-22-34(32)38(33,39)40)37-42-35(26-14-6-4-7-15-26)41-36(43-37)27-16-8-5-9-17-27/h2-24,35H,1H2,(H,41,42,43)/b12-3- |
| InChIKey | NOCLZIYFFSEBCP-BASWHVEKSA-N |
| XLogP | 9.17 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|