C42H29F2N3 — CID 135247150
2-(9,9-difluoro-7-phenanthren-2-yl-5,6-dihydrofluoren-2-yl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 135247150) has the molecular formula C42H29F2N3 and a molecular weight of 613.71 g/mol. Its IUPAC name is 2-(9,9-difluoro-7-phenanthren-2-yl-5,6-dihydrofluoren-2-yl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-(9,9-difluoro-7-phenanthren-2-yl-5,6-dihydrofluoren-2-yl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 135247150 |
| Molecular Formula | C42H29F2N3 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | 2-(9,9-difluoro-7-phenanthren-2-yl-5,6-dihydrofluoren-2-yl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | FC1(F)C2=C(CCC(c3ccc4c(ccc5ccccc54)c3)=C2)c2ccc(C3=NC(c4ccccc4)N=C(c4ccccc4)N3)cc21 |
| InChI | InChI=1S/C42H29F2N3/c43-42(44)37-24-30(29-17-20-34-31(23-29)16-15-26-9-7-8-14-33(26)34)18-21-35(37)36-22-19-32(25-38(36)42)41-46-39(27-10-3-1-4-11-27)45-40(47-41)28-12-5-2-6-13-28/h1-17,19-20,22-25,39H,18,21H2,(H,45,46,47) |
| InChIKey | KXRZZQSXGDFXBC-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|