C34H23F2N3 — CID 135247175
2-(9,9-difluoro-7-phenylfluoren-2-yl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 135247175) has the molecular formula C34H23F2N3 and a molecular weight of 511.58 g/mol. Its IUPAC name is 2-(9,9-difluoro-7-phenylfluoren-2-yl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-(9,9-difluoro-7-phenylfluoren-2-yl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 135247175 |
| Molecular Formula | C34H23F2N3 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | 2-(9,9-difluoro-7-phenylfluoren-2-yl)-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | FC1(F)c2cc(C3=NC(c4ccccc4)N=C(c4ccccc4)N3)ccc2-c2ccc(-c3ccccc3)cc21 |
| InChI | InChI=1S/C34H23F2N3/c35-34(36)29-20-25(22-10-4-1-5-11-22)16-18-27(29)28-19-17-26(21-30(28)34)33-38-31(23-12-6-2-7-13-23)37-32(39-33)24-14-8-3-9-15-24/h1-21,31H,(H,37,38,39) |
| InChIKey | BBZWNTLLWVLKEM-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |