C44H39F2N5 — CID 135247183
1-cyclohexa-1,3-dien-1-yl-3-[4-[9,9-difluoro-6-(1-methyl-2,6-diphenyl-2H-1,3,5-triazin-4-yl)fluoren-3-yl]cyclohexa-1,3-dien-1-yl]-3-iminopropan-1-amine (PubChem CID 135247183) has the molecular formula C44H39F2N5 and a molecular weight of 675.83 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-3-[4-[9,9-difluoro-6-(1-methyl-2,6-diphenyl-2H-1,3,5-triazin-4-yl)fluoren-3-yl]cyclohexa-1,3-dien-1-yl]-3-iminopropan-1-amine.
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-3-[4-[9,9-difluoro-6-(1-methyl-2,6-diphenyl-2H-1,3,5-triazin-4-yl)fluoren-3-yl]cyclohexa-1,3-dien-1-yl]-3-iminopropan-1-amine |
|---|---|
| PubChem CID | 135247183 |
| Molecular Formula | C44H39F2N5 |
| Molecular Weight | 675.83 g/mol |
| Exact Mass | 675.32 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-3-[4-[9,9-difluoro-6-(1-methyl-2,6-diphenyl-2H-1,3,5-triazin-4-yl)fluoren-3-yl]cyclohexa-1,3-dien-1-yl]-3-iminopropan-1-amine |
| SMILES | [H]/N=C(\CC(N)C1=CC=CCC1)C1=CC=C(c2ccc3c(c2)-c2cc(C4=NC(c5ccccc5)N(C)C(c5ccccc5)=N4)ccc2C3(F)F)CC1 |
| InChI | InChI=1S/C44H39F2N5/c1-51-42(31-13-7-3-8-14-31)49-41(50-43(51)32-15-9-4-10-16-32)34-22-24-38-36(26-34)35-25-33(21-23-37(35)44(38,45)46)28-17-19-30(20-18-28)40(48)27-39(47)29-11-5-2-6-12-29/h2-5,7-11,13-17,19,21-26,39,42,48H,6,12,18,20,27,47H2,1H3/b48-40+ |
| InChIKey | WQFCGFPLZDURGI-NUDBAZLPSA-N |
| XLogP | 9.76 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.83 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|