C58H42F2N4 — CID 135247184
2-[4-[9,9-difluoro-6-[4-(1-methyl-4,6-diphenyl-2H-pyridin-2-yl)phenyl]fluoren-3-yl]phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine (PubChem CID 135247184) has the molecular formula C58H42F2N4 and a molecular weight of 833.00 g/mol. Its IUPAC name is 2-[4-[9,9-difluoro-6-[4-(1-methyl-4,6-diphenyl-2H-pyridin-2-yl)phenyl]fluoren-3-yl]phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-[4-[9,9-difluoro-6-[4-(1-methyl-4,6-diphenyl-2H-pyridin-2-yl)phenyl]fluoren-3-yl]phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 135247184 |
| Molecular Formula | C58H42F2N4 |
| Molecular Weight | 833.00 g/mol |
| Exact Mass | 832.34 |
| IUPAC Name | 2-[4-[9,9-difluoro-6-[4-(1-methyl-4,6-diphenyl-2H-pyridin-2-yl)phenyl]fluoren-3-yl]phenyl]-4,6-diphenyl-1,4-dihydro-1,3,5-triazine |
| SMILES | CN1C(c2ccccc2)=CC(c2ccccc2)=CC1c1ccc(-c2ccc3c(c2)-c2cc(-c4ccc(C5=NC(c6ccccc6)N=C(c6ccccc6)N5)cc4)ccc2C3(F)F)cc1 |
| InChI | InChI=1S/C58H42F2N4/c1-64-53(41-16-8-3-9-17-41)36-48(38-14-6-2-7-15-38)37-54(64)42-26-22-39(23-27-42)46-30-32-51-49(34-46)50-35-47(31-33-52(50)58(51,59)60)40-24-28-45(29-25-40)57-62-55(43-18-10-4-11-19-43)61-56(63-57)44-20-12-5-13-21-44/h2-37,54-55H,1H3,(H,61,62,63) |
| InChIKey | XPHWPSNZXLZQTL-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 833.00 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |