C44H29FN6 — CID 135247229
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-fluoro-9-methylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 135247229) has the molecular formula C44H29FN6 and a molecular weight of 660.76 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-fluoro-9-methylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-fluoro-9-methylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 135247229 |
| Molecular Formula | C44H29FN6 |
| Molecular Weight | 660.76 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9-fluoro-9-methylfluoren-2-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | CC1(F)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc21 |
| InChI | InChI=1S/C44H29FN6/c1-44(45)36-26-32(42-48-38(28-14-6-2-7-15-28)46-39(49-42)29-16-8-3-9-17-29)22-24-34(36)35-25-23-33(27-37(35)44)43-50-40(30-18-10-4-11-19-30)47-41(51-43)31-20-12-5-13-21-31/h2-27H,1H3 |
| InChIKey | QKJCARFQLPNHCB-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.76 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |