C36H28F2N2 — CID 135247246
6-(9,9-difluorofluoren-2-yl)-4-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-2-phenyl-1,4-dihydropyrimidine (PubChem CID 135247246) has the molecular formula C36H28F2N2 and a molecular weight of 526.63 g/mol. Its IUPAC name is 6-(9,9-difluorofluoren-2-yl)-4-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-2-phenyl-1,4-dihydropyrimidine.
| Compound Name | 6-(9,9-difluorofluoren-2-yl)-4-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-2-phenyl-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 135247246 |
| Molecular Formula | C36H28F2N2 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 6-(9,9-difluorofluoren-2-yl)-4-[4-[(2Z,4Z)-hepta-2,4,6-trienyl]phenyl]-2-phenyl-1,4-dihydropyrimidine |
| SMILES | C=C/C=C\C=C/Cc1ccc(C2C=C(c3ccc4c(c3)C(F)(F)c3ccccc3-4)NC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C36H28F2N2/c1-2-3-4-5-7-12-25-17-19-26(20-18-25)33-24-34(40-35(39-33)27-13-8-6-9-14-27)28-21-22-30-29-15-10-11-16-31(29)36(37,38)32(30)23-28/h2-11,13-24,33H,1,12H2,(H,39,40)/b4-3-,7-5- |
| InChIKey | LRFCZJCCJCEKAV-MRWCJKGFSA-N |
| XLogP | 8.78 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|