About 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile
2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile (PubChem CID 135247872) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile.
Molecular Properties
| Compound Name | 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile |
| PubChem CID | 135247872 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile |
| SMILES | N#CC(O)C1C=CC=CC1 |
| InChI | InChI=1S/C8H9NO/c9-6-8(10)7-4-2-1-3-5-7/h1-4,7-8,10H,5H2 |
| InChIKey | KBSFZHYWWPRZEB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile?
The IUPAC name of 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile (CID 135247872) is 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile.
What is the SMILES notation for 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile?
The canonical SMILES for 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile is N#CC(O)C1C=CC=CC1.
What is the InChIKey of 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile?
The InChIKey is KBSFZHYWWPRZEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c9-6-8(10)7-4-2-1-3-5-7/h1-4,7-8,10H,5H2.
What are the key properties of 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile?
2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile has a molecular weight of 135.17 g/mol, XLogP of 1.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexa-2,4-dien-1-yl-2-hydroxyacetonitrile is sourced from PubChem (CID 135247872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).