C24H31N3O4 — CID 135247900
2-benzyl-5-[1,3-dihydroxy-1-(4-methoxyanilino)butan-2-yl]-2,5-diazaspiro[3.4]octan-3-one (PubChem CID 135247900) has the molecular formula C24H31N3O4 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-benzyl-5-[1,3-dihydroxy-1-(4-methoxyanilino)butan-2-yl]-2,5-diazaspiro[3.4]octan-3-one.
| Compound Name | 2-benzyl-5-[1,3-dihydroxy-1-(4-methoxyanilino)butan-2-yl]-2,5-diazaspiro[3.4]octan-3-one |
|---|---|
| PubChem CID | 135247900 |
| Molecular Formula | C24H31N3O4 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 2-benzyl-5-[1,3-dihydroxy-1-(4-methoxyanilino)butan-2-yl]-2,5-diazaspiro[3.4]octan-3-one |
| SMILES | COc1ccc(NC(O)C(C(C)O)N2CCCC23CN(Cc2ccccc2)C3=O)cc1 |
| InChI | InChI=1S/C24H31N3O4/c1-17(28)21(22(29)25-19-9-11-20(31-2)12-10-19)27-14-6-13-24(27)16-26(23(24)30)15-18-7-4-3-5-8-18/h3-5,7-12,17,21-22,25,28-29H,6,13-16H2,1-2H3 |
| InChIKey | XAYHZLGXYGOZQW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|