C15H20F2O — CID 135248142
(1R,3R,4R)-2-ethenyl-5-ethenylidene-1,4-difluoro-6-methoxy-1-methyl-3-prop-2-enylcyclohexane (PubChem CID 135248142) has the molecular formula C15H20F2O and a molecular weight of 254.32 g/mol. Its IUPAC name is (1R,3R,4R)-2-ethenyl-5-ethenylidene-1,4-difluoro-6-methoxy-1-methyl-3-prop-2-enylcyclohexane.
| Compound Name | (1R,3R,4R)-2-ethenyl-5-ethenylidene-1,4-difluoro-6-methoxy-1-methyl-3-prop-2-enylcyclohexane |
|---|---|
| PubChem CID | 135248142 |
| Molecular Formula | C15H20F2O |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | (1R,3R,4R)-2-ethenyl-5-ethenylidene-1,4-difluoro-6-methoxy-1-methyl-3-prop-2-enylcyclohexane |
| SMILES | C=C=C1C(OC)[C@](C)(F)C(C=C)[C@@H](CC=C)[C@H]1F |
| InChI | InChI=1S/C15H20F2O/c1-6-9-11-12(8-3)15(4,17)14(18-5)10(7-2)13(11)16/h6,8,11-14H,1-3,9H2,4-5H3/t11-,12?,13+,14?,15-/m1/s1 |
| InChIKey | NJVFMYABBHNXKX-DMVUBFGOSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|