C27H33NO2 — CID 135248237
(3E,4E)-5-[(2E,4Z,6E)-6-methoxyocta-2,4,6-trien-3-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one (PubChem CID 135248237) has the molecular formula C27H33NO2 and a molecular weight of 403.57 g/mol. Its IUPAC name is (3E,4E)-5-[(2E,4Z,6E)-6-methoxyocta-2,4,6-trien-3-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one.
| Compound Name | (3E,4E)-5-[(2E,4Z,6E)-6-methoxyocta-2,4,6-trien-3-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
|---|---|
| PubChem CID | 135248237 |
| Molecular Formula | C27H33NO2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | (3E,4E)-5-[(2E,4Z,6E)-6-methoxyocta-2,4,6-trien-3-yl]-5-[(2E,4Z)-5-methylhepta-2,4,6-trien-2-yl]-3,4-bis(prop-2-enylidene)pyrrolidin-2-one |
| SMILES | C=C/C=C1/C(=O)NC(/C(C)=C/C=C(/C)C=C)(C(/C=C\C(=C/C)OC)=C/C)/C1=C/C=C |
| InChI | InChI=1S/C27H33NO2/c1-9-14-24-25(15-10-2)27(28-26(24)29,21(7)17-16-20(6)11-3)22(12-4)18-19-23(13-5)30-8/h9-19H,1-3H2,4-8H3,(H,28,29)/b19-18-,20-16-,21-17+,22-12+,23-13+,24-14+,25-15+ |
| InChIKey | XPNFTJBMCFTXLU-YBNMRUFGSA-N |
| XLogP | 6.21 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|