C24H26N2 — CID 135248305
(3E,4Z)-3-ethylidene-2-(5-methyl-2-phenyl-1H-indol-3-yl)hepta-4,6-dien-1-amine (PubChem CID 135248305) has the molecular formula C24H26N2 and a molecular weight of 342.49 g/mol. Its IUPAC name is (3E,4Z)-3-ethylidene-2-(5-methyl-2-phenyl-1H-indol-3-yl)hepta-4,6-dien-1-amine.
| Compound Name | (3E,4Z)-3-ethylidene-2-(5-methyl-2-phenyl-1H-indol-3-yl)hepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 135248305 |
| Molecular Formula | C24H26N2 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | (3E,4Z)-3-ethylidene-2-(5-methyl-2-phenyl-1H-indol-3-yl)hepta-4,6-dien-1-amine |
| SMILES | C=C/C=C\C(=C/C)C(CN)c1c(-c2ccccc2)[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C24H26N2/c1-4-6-10-18(5-2)21(16-25)23-20-15-17(3)13-14-22(20)26-24(23)19-11-8-7-9-12-19/h4-15,21,26H,1,16,25H2,2-3H3/b10-6-,18-5+ |
| InChIKey | RHKPVEINKOTTOV-VEXZSJAPSA-N |
| XLogP | 5.87 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|