About ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate
ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate (PubChem CID 135248881) has the molecular formula C14H19F2NO3S2
and a molecular weight of 351.44 g/mol. Its IUPAC name is ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate |
| PubChem CID | 135248881 |
| Molecular Formula | C14H19F2NO3S2 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate |
| SMILES | CCCS(=O)Nc1ccc(F)c(SCCC(=O)OCC)c1F |
| InChI | InChI=1S/C14H19F2NO3S2/c1-3-9-22(19)17-11-6-5-10(15)14(13(11)16)21-8-7-12(18)20-4-2/h5-6,17H,3-4,7-9H2,1-2H3 |
| InChIKey | VZRHVIUDVQAEDI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate?
The IUPAC name of ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate (CID 135248881) is ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate.
What is the SMILES notation for ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate?
The canonical SMILES for ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate is CCCS(=O)Nc1ccc(F)c(SCCC(=O)OCC)c1F.
What is the InChIKey of ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate?
The InChIKey is VZRHVIUDVQAEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19F2NO3S2/c1-3-9-22(19)17-11-6-5-10(15)14(13(11)16)21-8-7-12(18)20-4-2/h5-6,17H,3-4,7-9H2,1-2H3.
What are the key properties of ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate?
ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate has a molecular weight of 351.44 g/mol, XLogP of 3.50, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2,6-difluoro-3-(propylsulfinylamino)phenyl]sulfanylpropanoate is sourced from PubChem (CID 135248881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).