C21H16ClIN2O — CID 135248883
5-(4-chlorophenyl)-3-iodo-1-[(4-methoxyphenyl)methyl]pyrrolo[2,3-b]pyridine (PubChem CID 135248883) has the molecular formula C21H16ClIN2O and a molecular weight of 474.73 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-iodo-1-[(4-methoxyphenyl)methyl]pyrrolo[2,3-b]pyridine.
| Compound Name | 5-(4-chlorophenyl)-3-iodo-1-[(4-methoxyphenyl)methyl]pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 135248883 |
| Molecular Formula | C21H16ClIN2O |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.00 |
| IUPAC Name | 5-(4-chlorophenyl)-3-iodo-1-[(4-methoxyphenyl)methyl]pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(Cn2cc(I)c3cc(-c4ccc(Cl)cc4)cnc32)cc1 |
| InChI | InChI=1S/C21H16ClIN2O/c1-26-18-8-2-14(3-9-18)12-25-13-20(23)19-10-16(11-24-21(19)25)15-4-6-17(22)7-5-15/h2-11,13H,12H2,1H3 |
| InChIKey | WHTMOVYTRIZULL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|