About (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol
(4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol (PubChem CID 135249338) has the molecular formula C11H13NO3
and a molecular weight of 207.23 g/mol. Its IUPAC name is (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol.
Molecular Properties
| Compound Name | (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol |
| PubChem CID | 135249338 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol |
| SMILES | Cc1ccc2c(c1)/C(=N\O)CC(C)(O)O2 |
| InChI | InChI=1S/C11H13NO3/c1-7-3-4-10-8(5-7)9(12-14)6-11(2,13)15-10/h3-5,13-14H,6H2,1-2H3/b12-9- |
| InChIKey | KPDSVICONVHQNF-XFXZXTDPSA-N |
| XLogP | 1.66 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol?
The IUPAC name of (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol (CID 135249338) is (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol.
What is the SMILES notation for (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol?
The canonical SMILES for (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol is Cc1ccc2c(c1)/C(=N\O)CC(C)(O)O2.
What is the InChIKey of (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol?
The InChIKey is KPDSVICONVHQNF-XFXZXTDPSA-N. The full InChI is InChI=1S/C11H13NO3/c1-7-3-4-10-8(5-7)9(12-14)6-11(2,13)15-10/h3-5,13-14H,6H2,1-2H3/b12-9-.
What are the key properties of (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol?
(4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol has a molecular weight of 207.23 g/mol, XLogP of 1.66, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-hydroxyimino-2,6-dimethyl-3H-chromen-2-ol is sourced from PubChem (CID 135249338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).