C44H42N4O2 — CID 135249854
4,4,5,5-tetramethyl-2-[5-[3-phenyl-10-[5-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)-2-pyridinyl]anthracen-9-yl]-2-pyridinyl]-1,3-oxazole (PubChem CID 135249854) has the molecular formula C44H42N4O2 and a molecular weight of 658.85 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[5-[3-phenyl-10-[5-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)-2-pyridinyl]anthracen-9-yl]-2-pyridinyl]-1,3-oxazole.
| Compound Name | 4,4,5,5-tetramethyl-2-[5-[3-phenyl-10-[5-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)-2-pyridinyl]anthracen-9-yl]-2-pyridinyl]-1,3-oxazole |
|---|---|
| PubChem CID | 135249854 |
| Molecular Formula | C44H42N4O2 |
| Molecular Weight | 658.85 g/mol |
| Exact Mass | 658.33 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[5-[3-phenyl-10-[5-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)-2-pyridinyl]anthracen-9-yl]-2-pyridinyl]-1,3-oxazole |
| SMILES | CC1(C)N=C(c2ccc(-c3c4ccccc4c(-c4ccc(C5=NC(C)(C)C(C)(C)O5)nc4)c4ccc(-c5ccccc5)cc34)nc2)OC1(C)C |
| InChI | InChI=1S/C44H42N4O2/c1-41(2)43(5,6)49-39(47-41)30-20-22-35(45-26-30)38-32-17-13-12-16-31(32)37(33-21-18-28(24-34(33)38)27-14-10-9-11-15-27)29-19-23-36(46-25-29)40-48-42(3,4)44(7,8)50-40/h9-26H,1-8H3 |
| InChIKey | ZVLRCZXONDKSME-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.85 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|