C34H30N4O2 — CID 135249897
2-[5-[10-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]anthracen-9-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 135249897) has the molecular formula C34H30N4O2 and a molecular weight of 526.64 g/mol. Its IUPAC name is 2-[5-[10-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]anthracen-9-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[5-[10-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]anthracen-9-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 135249897 |
| Molecular Formula | C34H30N4O2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 2-[5-[10-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]anthracen-9-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccc(-c3c4ccccc4c(-c4ccc(C5=NC(C)(C)CO5)nc4)c4ccccc34)cn2)=N1 |
| InChI | InChI=1S/C34H30N4O2/c1-33(2)19-39-31(37-33)27-15-13-21(17-35-27)29-23-9-5-7-11-25(23)30(26-12-8-6-10-24(26)29)22-14-16-28(36-18-22)32-38-34(3,4)20-40-32/h5-18H,19-20H2,1-4H3 |
| InChIKey | UUNNGHQABYBHAR-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|