C53H48N4S2 — CID 135250011
2-[6-[7,7-diphenyl-9-[6-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-2-pyridinyl]benzo[c]fluoren-5-yl]-2-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole (PubChem CID 135250011) has the molecular formula C53H48N4S2 and a molecular weight of 805.13 g/mol. Its IUPAC name is 2-[6-[7,7-diphenyl-9-[6-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-2-pyridinyl]benzo[c]fluoren-5-yl]-2-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole.
| Compound Name | 2-[6-[7,7-diphenyl-9-[6-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-2-pyridinyl]benzo[c]fluoren-5-yl]-2-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole |
|---|---|
| PubChem CID | 135250011 |
| Molecular Formula | C53H48N4S2 |
| Molecular Weight | 805.13 g/mol |
| Exact Mass | 804.33 |
| IUPAC Name | 2-[6-[7,7-diphenyl-9-[6-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-2-pyridinyl]benzo[c]fluoren-5-yl]-2-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole |
| SMILES | CC1(C)N=C(c2cccc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3cc(-c5cccc(C6=NC(C)(C)C(C)(C)S6)n5)c5ccccc5c3-4)n2)SC1(C)C |
| InChI | InChI=1S/C53H48N4S2/c1-49(2)51(5,6)58-47(56-49)44-27-17-25-42(54-44)33-29-30-38-40(31-33)53(34-19-11-9-12-20-34,35-21-13-10-14-22-35)41-32-39(36-23-15-16-24-37(36)46(38)41)43-26-18-28-45(55-43)48-57-50(3,4)52(7,8)59-48/h9-32H,1-8H3 |
| InChIKey | HZKCSOROYUVJHO-UHFFFAOYSA-N |
| XLogP | 13.43 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.13 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |