C48H45N3S2 — CID 135250175
4,4,5,5-tetramethyl-2-[3-[11-phenyl-3-[3-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)phenyl]benzo[a]carbazol-9-yl]phenyl]-1,3-thiazole (PubChem CID 135250175) has the molecular formula C48H45N3S2 and a molecular weight of 728.04 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-[11-phenyl-3-[3-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)phenyl]benzo[a]carbazol-9-yl]phenyl]-1,3-thiazole.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-[11-phenyl-3-[3-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)phenyl]benzo[a]carbazol-9-yl]phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 135250175 |
| Molecular Formula | C48H45N3S2 |
| Molecular Weight | 728.04 g/mol |
| Exact Mass | 727.31 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-[11-phenyl-3-[3-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)phenyl]benzo[a]carbazol-9-yl]phenyl]-1,3-thiazole |
| SMILES | CC1(C)N=C(c2cccc(-c3ccc4c(ccc5c6ccc(-c7cccc(C8=NC(C)(C)C(C)(C)S8)c7)cc6n(-c6ccccc6)c45)c3)c2)SC1(C)C |
| InChI | InChI=1S/C48H45N3S2/c1-45(2)47(5,6)52-43(49-45)35-16-12-14-30(27-35)32-20-23-38-34(26-32)22-25-40-39-24-21-33(29-41(39)51(42(38)40)37-18-10-9-11-19-37)31-15-13-17-36(28-31)44-50-46(3,4)48(7,8)53-44/h9-29H,1-8H3 |
| InChIKey | NHZLISFEEQTTMI-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 29.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.04 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |