C38H32N4O2 — CID 135250453
2-[5-[4-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]triphenylen-1-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 135250453) has the molecular formula C38H32N4O2 and a molecular weight of 576.70 g/mol. Its IUPAC name is 2-[5-[4-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]triphenylen-1-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[5-[4-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]triphenylen-1-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 135250453 |
| Molecular Formula | C38H32N4O2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | 2-[5-[4-[6-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-3-pyridinyl]triphenylen-1-yl]-2-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccc(-c3ccc(-c4ccc(C5=NC(C)(C)CO5)nc4)c4c5ccccc5c5ccccc5c34)cn2)=N1 |
| InChI | InChI=1S/C38H32N4O2/c1-37(2)21-43-35(41-37)31-17-13-23(19-39-31)25-15-16-26(24-14-18-32(40-20-24)36-42-38(3,4)22-44-36)34-30-12-8-6-10-28(30)27-9-5-7-11-29(27)33(25)34/h5-20H,21-22H2,1-4H3 |
| InChIKey | KEIAOJLONFJXBQ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|