C35H31N7O2 — CID 135250592
2-[6-[4-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 135250592) has the molecular formula C35H31N7O2 and a molecular weight of 581.68 g/mol. Its IUPAC name is 2-[6-[4-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[6-[4-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 135250592 |
| Molecular Formula | C35H31N7O2 |
| Molecular Weight | 581.68 g/mol |
| Exact Mass | 581.25 |
| IUPAC Name | 2-[6-[4-[5-(4,4-dimethyl-5H-1,3-oxazol-2-yl)-2-pyridinyl]-6-(4-phenylphenyl)-1,3,5-triazin-2-yl]-3-pyridinyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccc(-c3nc(-c4ccc(-c5ccccc5)cc4)nc(-c4ccc(C5=NC(C)(C)CO5)cn4)n3)nc2)=N1 |
| InChI | InChI=1S/C35H31N7O2/c1-34(2)20-43-32(41-34)25-14-16-27(36-18-25)30-38-29(24-12-10-23(11-13-24)22-8-6-5-7-9-22)39-31(40-30)28-17-15-26(19-37-28)33-42-35(3,4)21-44-33/h5-19H,20-21H2,1-4H3 |
| InChIKey | KMLYEFGWBDYQRD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 107.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |