C42H42N4O2 — CID 135250622
4,4,5,5-tetramethyl-2-[3-[4-(4-phenylphenyl)-6-[3-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)phenyl]pyrimidin-2-yl]phenyl]-1,3-oxazole (PubChem CID 135250622) has the molecular formula C42H42N4O2 and a molecular weight of 634.82 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-[4-(4-phenylphenyl)-6-[3-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)phenyl]pyrimidin-2-yl]phenyl]-1,3-oxazole.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-[4-(4-phenylphenyl)-6-[3-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)phenyl]pyrimidin-2-yl]phenyl]-1,3-oxazole |
|---|---|
| PubChem CID | 135250622 |
| Molecular Formula | C42H42N4O2 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-[4-(4-phenylphenyl)-6-[3-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)phenyl]pyrimidin-2-yl]phenyl]-1,3-oxazole |
| SMILES | CC1(C)N=C(c2cccc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4cccc(C5=NC(C)(C)C(C)(C)O5)c4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C42H42N4O2/c1-39(2)41(5,6)47-37(45-39)32-18-12-16-30(24-32)35-26-34(29-22-20-28(21-23-29)27-14-10-9-11-15-27)43-36(44-35)31-17-13-19-33(25-31)38-46-40(3,4)42(7,8)48-38/h9-26H,1-8H3 |
| InChIKey | VAUVBOPKJKYUQQ-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |