C40H40N6O2 — CID 135250638
4,4,5,5-tetramethyl-2-[5-[4-(4-phenylphenyl)-6-[5-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)-3-pyridinyl]pyrimidin-2-yl]-3-pyridinyl]-1,3-oxazole (PubChem CID 135250638) has the molecular formula C40H40N6O2 and a molecular weight of 636.80 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[5-[4-(4-phenylphenyl)-6-[5-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)-3-pyridinyl]pyrimidin-2-yl]-3-pyridinyl]-1,3-oxazole.
| Compound Name | 4,4,5,5-tetramethyl-2-[5-[4-(4-phenylphenyl)-6-[5-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)-3-pyridinyl]pyrimidin-2-yl]-3-pyridinyl]-1,3-oxazole |
|---|---|
| PubChem CID | 135250638 |
| Molecular Formula | C40H40N6O2 |
| Molecular Weight | 636.80 g/mol |
| Exact Mass | 636.32 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[5-[4-(4-phenylphenyl)-6-[5-(4,4,5,5-tetramethyl-1,3-oxazol-2-yl)-3-pyridinyl]pyrimidin-2-yl]-3-pyridinyl]-1,3-oxazole |
| SMILES | CC1(C)N=C(c2cncc(-c3cc(-c4ccc(-c5ccccc5)cc4)nc(-c4cncc(C5=NC(C)(C)C(C)(C)O5)c4)n3)c2)OC1(C)C |
| InChI | InChI=1S/C40H40N6O2/c1-37(2)39(5,6)47-35(45-37)30-18-28(21-41-23-30)33-20-32(27-16-14-26(15-17-27)25-12-10-9-11-13-25)43-34(44-33)29-19-31(24-42-22-29)36-46-38(3,4)40(7,8)48-36/h9-24H,1-8H3 |
| InChIKey | YIUQSVBTJKKNFR-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 94.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.80 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |