C41H41N5O — CID 135250658
4,4-dimethyl-2-[3-[2-[3-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-5H-1,3-oxazole (PubChem CID 135250658) has the molecular formula C41H41N5O and a molecular weight of 619.81 g/mol. Its IUPAC name is 4,4-dimethyl-2-[3-[2-[3-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-5H-1,3-oxazole.
| Compound Name | 4,4-dimethyl-2-[3-[2-[3-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-5H-1,3-oxazole |
|---|---|
| PubChem CID | 135250658 |
| Molecular Formula | C41H41N5O |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.33 |
| IUPAC Name | 4,4-dimethyl-2-[3-[2-[3-(2,4,4,5,5-pentamethylimidazol-1-yl)phenyl]-6-(4-phenylphenyl)pyrimidin-4-yl]phenyl]-5H-1,3-oxazole |
| SMILES | CC1=NC(C)(C)C(C)(C)N1c1cccc(-c2nc(-c3ccc(-c4ccccc4)cc3)cc(-c3cccc(C4=NC(C)(C)CO4)c3)n2)c1 |
| InChI | InChI=1S/C41H41N5O/c1-27-44-40(4,5)41(6,7)46(27)34-18-12-16-32(24-34)37-42-35(30-21-19-29(20-22-30)28-13-9-8-10-14-28)25-36(43-37)31-15-11-17-33(23-31)38-45-39(2,3)26-47-38/h8-25H,26H2,1-7H3 |
| InChIKey | YBFGCJRCISRINR-UHFFFAOYSA-N |
| XLogP | 9.50 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |