C39H45N9S3 — CID 135250806
2-[5-[4,6-bis[6-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-3-pyridinyl]-1,3,5-triazin-2-yl]-2-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole (PubChem CID 135250806) has the molecular formula C39H45N9S3 and a molecular weight of 736.05 g/mol. Its IUPAC name is 2-[5-[4,6-bis[6-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-3-pyridinyl]-1,3,5-triazin-2-yl]-2-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole.
| Compound Name | 2-[5-[4,6-bis[6-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-3-pyridinyl]-1,3,5-triazin-2-yl]-2-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole |
|---|---|
| PubChem CID | 135250806 |
| Molecular Formula | C39H45N9S3 |
| Molecular Weight | 736.05 g/mol |
| Exact Mass | 735.30 |
| IUPAC Name | 2-[5-[4,6-bis[6-(4,4,5,5-tetramethyl-1,3-thiazol-2-yl)-3-pyridinyl]-1,3,5-triazin-2-yl]-2-pyridinyl]-4,4,5,5-tetramethyl-1,3-thiazole |
| SMILES | CC1(C)N=C(c2ccc(-c3nc(-c4ccc(C5=NC(C)(C)C(C)(C)S5)nc4)nc(-c4ccc(C5=NC(C)(C)C(C)(C)S5)nc4)n3)cn2)SC1(C)C |
| InChI | InChI=1S/C39H45N9S3/c1-34(2)37(7,8)49-31(46-34)25-16-13-22(19-40-25)28-43-29(23-14-17-26(41-20-23)32-47-35(3,4)38(9,10)50-32)45-30(44-28)24-15-18-27(42-21-24)33-48-36(5,6)39(11,12)51-33/h13-21H,1-12H3 |
| InChIKey | WLQSQCJWKYOVEG-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 114.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.05 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |