C19H22F6N2O3 — CID 135251269
1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 135251269) has the molecular formula C19H22F6N2O3 and a molecular weight of 440.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 135251269 |
| Molecular Formula | C19H22F6N2O3 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-benzyl-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CC1)CN(Cc1ccccc1)CCO2 |
| InChI | InChI=1S/C19H22F6N2O3/c20-18(21,22)15(19(23,24)25)30-16(28)27-8-6-17(7-9-27)13-26(10-11-29-17)12-14-4-2-1-3-5-14/h1-5,15H,6-13H2 |
| InChIKey | IHENKTNDBYGHRU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |