C19H21F7N2O3 — CID 135251270
1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-fluorophenyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 135251270) has the molecular formula C19H21F7N2O3 and a molecular weight of 458.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-fluorophenyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-fluorophenyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 135251270 |
| Molecular Formula | C19H21F7N2O3 |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-[(4-fluorophenyl)methyl]-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CC1)CN(Cc1ccc(F)cc1)CCO2 |
| InChI | InChI=1S/C19H21F7N2O3/c20-14-3-1-13(2-4-14)11-27-9-10-30-17(12-27)5-7-28(8-6-17)16(29)31-15(18(21,22)23)19(24,25)26/h1-4,15H,5-12H2 |
| InChIKey | CIHCIHSHFAQXIJ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |