C16H19F6N3O3S — CID 135251273
1,1,1,3,3,3-hexafluoropropan-2-yl 4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 135251273) has the molecular formula C16H19F6N3O3S and a molecular weight of 447.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 135251273 |
| Molecular Formula | C16H19F6N3O3S |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(1,3-thiazol-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CC1)CN(Cc1nccs1)CCO2 |
| InChI | InChI=1S/C16H19F6N3O3S/c17-15(18,19)12(16(20,21)22)28-13(26)25-4-1-14(2-5-25)10-24(6-7-27-14)9-11-23-3-8-29-11/h3,8,12H,1-2,4-7,9-10H2 |
| InChIKey | OQIMYDSTKYBGPR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |