C18H21F6N3O3 — CID 135251276
1,1,1,3,3,3-hexafluoropropan-2-yl 4-(pyridin-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate (PubChem CID 135251276) has the molecular formula C18H21F6N3O3 and a molecular weight of 441.37 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(pyridin-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(pyridin-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
|---|---|
| PubChem CID | 135251276 |
| Molecular Formula | C18H21F6N3O3 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 4-(pyridin-2-ylmethyl)-1-oxa-4,9-diazaspiro[5.5]undecane-9-carboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)N1CCC2(CC1)CN(Cc1ccccn1)CCO2 |
| InChI | InChI=1S/C18H21F6N3O3/c19-17(20,21)14(18(22,23)24)30-15(28)27-7-4-16(5-8-27)12-26(9-10-29-16)11-13-3-1-2-6-25-13/h1-3,6,14H,4-5,7-12H2 |
| InChIKey | YUIWXMFZUMNISF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |