C18H26F6N2O4 — CID 135251286
1,1,1,3,3,3-hexafluoropropan-2-yl 3-[2,2-dimethylpropanoyl(methyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate (PubChem CID 135251286) has the molecular formula C18H26F6N2O4 and a molecular weight of 448.40 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[2,2-dimethylpropanoyl(methyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[2,2-dimethylpropanoyl(methyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 135251286 |
| Molecular Formula | C18H26F6N2O4 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 3-[2,2-dimethylpropanoyl(methyl)amino]-1-oxa-8-azaspiro[4.5]decane-8-carboxylate |
| SMILES | CN(C(=O)C(C)(C)C)C1COC2(CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C18H26F6N2O4/c1-15(2,3)13(27)25(4)11-9-16(29-10-11)5-7-26(8-6-16)14(28)30-12(17(19,20)21)18(22,23)24/h11-12H,5-10H2,1-4H3 |
| InChIKey | YCJVVNWGXWNEKV-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |