About methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate
methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate (PubChem CID 135251332) has the molecular formula C12H13FO4
and a molecular weight of 240.23 g/mol. Its IUPAC name is methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate |
| PubChem CID | 135251332 |
| Molecular Formula | C12H13FO4 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate |
| SMILES | COC(=O)C1=C(C2C=C(OC)C=C2F)COC1 |
| InChI | InChI=1S/C12H13FO4/c1-15-7-3-8(11(13)4-7)9-5-17-6-10(9)12(14)16-2/h3-4,8H,5-6H2,1-2H3 |
| InChIKey | MRYRBNLCEJLDGI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate?
The IUPAC name of methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate (CID 135251332) is methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate.
What is the SMILES notation for methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate?
The canonical SMILES for methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate is COC(=O)C1=C(C2C=C(OC)C=C2F)COC1.
What is the InChIKey of methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate?
The InChIKey is MRYRBNLCEJLDGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FO4/c1-15-7-3-8(11(13)4-7)9-5-17-6-10(9)12(14)16-2/h3-4,8H,5-6H2,1-2H3.
What are the key properties of methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate?
methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate has a molecular weight of 240.23 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(2-fluoro-4-methoxycyclopenta-2,4-dien-1-yl)-2,5-dihydrofuran-3-carboxylate is sourced from PubChem (CID 135251332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).