About (4R,5R)-4,5-dimethyl-1,3-dithiolane
(4R,5R)-4,5-dimethyl-1,3-dithiolane (PubChem CID 135251680) has the molecular formula C5H10S2
and a molecular weight of 134.27 g/mol. Its IUPAC name is (4R,5R)-4,5-dimethyl-1,3-dithiolane.
Molecular Properties
| Compound Name | (4R,5R)-4,5-dimethyl-1,3-dithiolane |
| PubChem CID | 135251680 |
| Molecular Formula | C5H10S2 |
| Molecular Weight | 134.27 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | (4R,5R)-4,5-dimethyl-1,3-dithiolane |
| SMILES | C[C@H]1SCS[C@@H]1C |
| InChI | InChI=1S/C5H10S2/c1-4-5(2)7-3-6-4/h4-5H,3H2,1-2H3/t4-,5-/m1/s1 |
| InChIKey | VDKQRNZRLREXBM-RFZPGFLSSA-N |
| XLogP | 2.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R,5R)-4,5-dimethyl-1,3-dithiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-4,5-dimethyl-1,3-dithiolane?
The IUPAC name of (4R,5R)-4,5-dimethyl-1,3-dithiolane (CID 135251680) is (4R,5R)-4,5-dimethyl-1,3-dithiolane.
What is the SMILES notation for (4R,5R)-4,5-dimethyl-1,3-dithiolane?
The canonical SMILES for (4R,5R)-4,5-dimethyl-1,3-dithiolane is C[C@H]1SCS[C@@H]1C.
What is the InChIKey of (4R,5R)-4,5-dimethyl-1,3-dithiolane?
The InChIKey is VDKQRNZRLREXBM-RFZPGFLSSA-N. The full InChI is InChI=1S/C5H10S2/c1-4-5(2)7-3-6-4/h4-5H,3H2,1-2H3/t4-,5-/m1/s1.
What are the key properties of (4R,5R)-4,5-dimethyl-1,3-dithiolane?
(4R,5R)-4,5-dimethyl-1,3-dithiolane has a molecular weight of 134.27 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-4,5-dimethyl-1,3-dithiolane is sourced from PubChem (CID 135251680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).