About 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene
2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene (PubChem CID 135252077) has the molecular formula C16H25Cl
and a molecular weight of 252.83 g/mol. Its IUPAC name is 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene |
| PubChem CID | 135252077 |
| Molecular Formula | C16H25Cl |
| Molecular Weight | 252.83 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(Cl)cc(C(C)C)c1C(C)(C)C |
| InChI | InChI=1S/C16H25Cl/c1-10(2)13-8-12(17)9-14(11(3)4)15(13)16(5,6)7/h8-11H,1-7H3 |
| InChIKey | BLIJDYSDEFKVQF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.83 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene?
The IUPAC name of 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene (CID 135252077) is 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene.
What is the SMILES notation for 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene?
The canonical SMILES for 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene is CC(C)c1cc(Cl)cc(C(C)C)c1C(C)(C)C.
What is the InChIKey of 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene?
The InChIKey is BLIJDYSDEFKVQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25Cl/c1-10(2)13-8-12(17)9-14(11(3)4)15(13)16(5,6)7/h8-11H,1-7H3.
What are the key properties of 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene?
2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene has a molecular weight of 252.83 g/mol, XLogP of 5.88, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-chloro-1,3-di(propan-2-yl)benzene is sourced from PubChem (CID 135252077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).