About 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine
4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine (PubChem CID 135252219) has the molecular formula C13H26FN
and a molecular weight of 215.36 g/mol. Its IUPAC name is 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine |
| PubChem CID | 135252219 |
| Molecular Formula | C13H26FN |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine |
| SMILES | CC(C)C1CC(F)CC(C(C)C)C1(C)N |
| InChI | InChI=1S/C13H26FN/c1-8(2)11-6-10(14)7-12(9(3)4)13(11,5)15/h8-12H,6-7,15H2,1-5H3 |
| InChIKey | ZMGUHRXBYWJIQC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine?
The IUPAC name of 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine (CID 135252219) is 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine.
What is the SMILES notation for 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine?
The canonical SMILES for 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine is CC(C)C1CC(F)CC(C(C)C)C1(C)N.
What is the InChIKey of 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine?
The InChIKey is ZMGUHRXBYWJIQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26FN/c1-8(2)11-6-10(14)7-12(9(3)4)13(11,5)15/h8-12H,6-7,15H2,1-5H3.
What are the key properties of 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine?
4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine has a molecular weight of 215.36 g/mol, XLogP of 3.38, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-methyl-2,6-di(propan-2-yl)cyclohexan-1-amine is sourced from PubChem (CID 135252219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).