C41H29N3O2S — CID 135252723
7,7-dimethyl-5-[4-[4-(1,6-naphthyridin-4-yl)phenyl]sulfonylphenyl]indeno[2,1-b]carbazole (PubChem CID 135252723) has the molecular formula C41H29N3O2S and a molecular weight of 627.77 g/mol. Its IUPAC name is 7,7-dimethyl-5-[4-[4-(1,6-naphthyridin-4-yl)phenyl]sulfonylphenyl]indeno[2,1-b]carbazole.
| Compound Name | 7,7-dimethyl-5-[4-[4-(1,6-naphthyridin-4-yl)phenyl]sulfonylphenyl]indeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 135252723 |
| Molecular Formula | C41H29N3O2S |
| Molecular Weight | 627.77 g/mol |
| Exact Mass | 627.20 |
| IUPAC Name | 7,7-dimethyl-5-[4-[4-(1,6-naphthyridin-4-yl)phenyl]sulfonylphenyl]indeno[2,1-b]carbazole |
| SMILES | CC1(C)c2ccccc2-c2cc3c4ccccc4n(-c4ccc(S(=O)(=O)c5ccc(-c6ccnc7ccncc67)cc5)cc4)c3cc21 |
| InChI | InChI=1S/C41H29N3O2S/c1-41(2)36-9-5-3-7-31(36)33-23-34-32-8-4-6-10-39(32)44(40(34)24-37(33)41)27-13-17-29(18-14-27)47(45,46)28-15-11-26(12-16-28)30-19-22-43-38-20-21-42-25-35(30)38/h3-25H,1-2H3 |
| InChIKey | VJUBFPRSZSVEEQ-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.77 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |