C40H38N4O7S — CID 135252952
naphthalen-1-yl N-[6-[[(3'-hydroxy-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]methylamino]oxyhexyl]carbamate (PubChem CID 135252952) has the molecular formula C40H38N4O7S and a molecular weight of 718.83 g/mol. Its IUPAC name is naphthalen-1-yl N-[6-[[(3'-hydroxy-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]methylamino]oxyhexyl]carbamate.
| Compound Name | naphthalen-1-yl N-[6-[[(3'-hydroxy-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]methylamino]oxyhexyl]carbamate |
|---|---|
| PubChem CID | 135252952 |
| Molecular Formula | C40H38N4O7S |
| Molecular Weight | 718.83 g/mol |
| Exact Mass | 718.25 |
| IUPAC Name | naphthalen-1-yl N-[6-[[(3'-hydroxy-6'-methyl-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-yl)carbamothioylamino]methylamino]oxyhexyl]carbamate |
| SMILES | Cc1ccc2c(c1)Oc1cc(O)ccc1C21OC(=O)c2cc(NC(=S)NCNOCCCCCCNC(=O)Oc3cccc4ccccc34)ccc21 |
| InChI | InChI=1S/C40H38N4O7S/c1-25-13-16-32-35(21-25)49-36-23-28(45)15-18-33(36)40(32)31-17-14-27(22-30(31)37(46)51-40)44-38(52)42-24-43-48-20-7-3-2-6-19-41-39(47)50-34-12-8-10-26-9-4-5-11-29(26)34/h4-5,8-18,21-23,43,45H,2-3,6-7,19-20,24H2,1H3,(H,41,47)(H2,42,44,52) |
| InChIKey | OGQZVUZNSXIIPT-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 139.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.83 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|