About (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine
(3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine (PubChem CID 135253699) has the molecular formula C15H25N3
and a molecular weight of 247.39 g/mol. Its IUPAC name is (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine.
Molecular Properties
| Compound Name | (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine |
| PubChem CID | 135253699 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine |
| SMILES | C[C@@H]1CN(c2ccc(C(C)(C)C)nc2)C[C@H](C)N1 |
| InChI | InChI=1S/C15H25N3/c1-11-9-18(10-12(2)17-11)13-6-7-14(16-8-13)15(3,4)5/h6-8,11-12,17H,9-10H2,1-5H3/t11-,12+ |
| InChIKey | FPVLEPMUABHDTL-TXEJJXNPSA-N |
| XLogP | 2.57 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine?
The IUPAC name of (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine (CID 135253699) is (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine.
What is the SMILES notation for (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine?
The canonical SMILES for (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine is C[C@@H]1CN(c2ccc(C(C)(C)C)nc2)C[C@H](C)N1.
What is the InChIKey of (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine?
The InChIKey is FPVLEPMUABHDTL-TXEJJXNPSA-N. The full InChI is InChI=1S/C15H25N3/c1-11-9-18(10-12(2)17-11)13-6-7-14(16-8-13)15(3,4)5/h6-8,11-12,17H,9-10H2,1-5H3/t11-,12+.
What are the key properties of (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine?
(3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine has a molecular weight of 247.39 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-1-(6-tert-butyl-3-pyridinyl)-3,5-dimethylpiperazine is sourced from PubChem (CID 135253699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).