About 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one
8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one (PubChem CID 135253791) has the molecular formula C8H7ClN2O
and a molecular weight of 182.61 g/mol. Its IUPAC name is 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one.
Molecular Properties
| Compound Name | 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one |
| PubChem CID | 135253791 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one |
| SMILES | O=C1CCNc2c(Cl)ccnc21 |
| InChI | InChI=1S/C8H7ClN2O/c9-5-1-3-11-8-6(12)2-4-10-7(5)8/h1,3,10H,2,4H2 |
| InChIKey | AHYIIUDMNHIJQL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one?
The IUPAC name of 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one (CID 135253791) is 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one.
What is the SMILES notation for 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one?
The canonical SMILES for 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one is O=C1CCNc2c(Cl)ccnc21.
What is the InChIKey of 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one?
The InChIKey is AHYIIUDMNHIJQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClN2O/c9-5-1-3-11-8-6(12)2-4-10-7(5)8/h1,3,10H,2,4H2.
What are the key properties of 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one?
8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one has a molecular weight of 182.61 g/mol, XLogP of 1.73, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2,3-dihydro-1H-1,5-naphthyridin-4-one is sourced from PubChem (CID 135253791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).