About (2E)-2-ethylidene-1,6-dimethylpyrimidine
(2E)-2-ethylidene-1,6-dimethylpyrimidine (PubChem CID 135253872) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (2E)-2-ethylidene-1,6-dimethylpyrimidine.
Molecular Properties
| Compound Name | (2E)-2-ethylidene-1,6-dimethylpyrimidine |
| PubChem CID | 135253872 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2E)-2-ethylidene-1,6-dimethylpyrimidine |
| SMILES | C/C=C1/N=CC=C(C)N1C |
| InChI | InChI=1S/C8H12N2/c1-4-8-9-6-5-7(2)10(8)3/h4-6H,1-3H3/b8-4- |
| InChIKey | OKIDOQVAJBNGAC-YWEYNIOJSA-N |
| XLogP | 1.77 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E)-2-ethylidene-1,6-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethylidene-1,6-dimethylpyrimidine?
The IUPAC name of (2E)-2-ethylidene-1,6-dimethylpyrimidine (CID 135253872) is (2E)-2-ethylidene-1,6-dimethylpyrimidine.
What is the SMILES notation for (2E)-2-ethylidene-1,6-dimethylpyrimidine?
The canonical SMILES for (2E)-2-ethylidene-1,6-dimethylpyrimidine is C/C=C1/N=CC=C(C)N1C.
What is the InChIKey of (2E)-2-ethylidene-1,6-dimethylpyrimidine?
The InChIKey is OKIDOQVAJBNGAC-YWEYNIOJSA-N. The full InChI is InChI=1S/C8H12N2/c1-4-8-9-6-5-7(2)10(8)3/h4-6H,1-3H3/b8-4-.
What are the key properties of (2E)-2-ethylidene-1,6-dimethylpyrimidine?
(2E)-2-ethylidene-1,6-dimethylpyrimidine has a molecular weight of 136.20 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethylidene-1,6-dimethylpyrimidine is sourced from PubChem (CID 135253872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).