C22H21ClN2O — CID 135253923
(R)-[2-(3-chloro-4-methylphenyl)quinolin-4-yl]-[(6R)-1,2,3,6-tetrahydropyridin-6-yl]methanol (PubChem CID 135253923) has the molecular formula C22H21ClN2O and a molecular weight of 364.88 g/mol. Its IUPAC name is (R)-[2-(3-chloro-4-methylphenyl)quinolin-4-yl]-[(6R)-1,2,3,6-tetrahydropyridin-6-yl]methanol.
| Compound Name | (R)-[2-(3-chloro-4-methylphenyl)quinolin-4-yl]-[(6R)-1,2,3,6-tetrahydropyridin-6-yl]methanol |
|---|---|
| PubChem CID | 135253923 |
| Molecular Formula | C22H21ClN2O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (R)-[2-(3-chloro-4-methylphenyl)quinolin-4-yl]-[(6R)-1,2,3,6-tetrahydropyridin-6-yl]methanol |
| SMILES | Cc1ccc(-c2cc([C@@H](O)[C@H]3C=CCCN3)c3ccccc3n2)cc1Cl |
| InChI | InChI=1S/C22H21ClN2O/c1-14-9-10-15(12-18(14)23)21-13-17(16-6-2-3-7-19(16)25-21)22(26)20-8-4-5-11-24-20/h2-4,6-10,12-13,20,22,24,26H,5,11H2,1H3/t20-,22-/m1/s1 |
| InChIKey | HETIVHRRELDJRH-IFMALSPDSA-N |
| XLogP | 4.82 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|