About (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine
(2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine (PubChem CID 135254595) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine.
Molecular Properties
| Compound Name | (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine |
| PubChem CID | 135254595 |
| Molecular Formula | C8H13N3 |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.11 |
| IUPAC Name | (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine |
| SMILES | [H]/N=C/C(=C\C)C(/C=C(\C)N)=N/[H] |
| InChI | InChI=1S/C8H13N3/c1-3-7(5-9)8(11)4-6(2)10/h3-5,9,11H,10H2,1-2H3/b6-4+,7-3+,9-5+,11-8+ |
| InChIKey | OARSHGMOIUBDMM-UPZQRRLHSA-N |
| XLogP | 1.46 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine?
The IUPAC name of (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine (CID 135254595) is (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine.
What is the SMILES notation for (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine?
The canonical SMILES for (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine is [H]/N=C/C(=C\C)C(/C=C(\C)N)=N/[H].
What is the InChIKey of (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine?
The InChIKey is OARSHGMOIUBDMM-UPZQRRLHSA-N. The full InChI is InChI=1S/C8H13N3/c1-3-7(5-9)8(11)4-6(2)10/h3-5,9,11H,10H2,1-2H3/b6-4+,7-3+,9-5+,11-8+.
What are the key properties of (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine?
(2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine has a molecular weight of 151.21 g/mol, XLogP of 1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,5E)-4-imino-5-methanimidoylhepta-2,5-dien-2-amine is sourced from PubChem (CID 135254595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).