About 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate
3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate (PubChem CID 135255372) has the molecular formula C16H25NO6
and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate |
| PubChem CID | 135255372 |
| Molecular Formula | C16H25NO6 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate |
| SMILES | CC(C)CCOC(=O)C1=CN(C2OC(CO)C(O)C2O)C=CC1 |
| InChI | InChI=1S/C16H25NO6/c1-10(2)5-7-22-16(21)11-4-3-6-17(8-11)15-14(20)13(19)12(9-18)23-15/h3,6,8,10,12-15,18-20H,4-5,7,9H2,1-2H3 |
| InChIKey | GIZHUYJTVWCWLN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate?
The IUPAC name of 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate (CID 135255372) is 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate.
What is the SMILES notation for 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate?
The canonical SMILES for 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate is CC(C)CCOC(=O)C1=CN(C2OC(CO)C(O)C2O)C=CC1.
What is the InChIKey of 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate?
The InChIKey is GIZHUYJTVWCWLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO6/c1-10(2)5-7-22-16(21)11-4-3-6-17(8-11)15-14(20)13(19)12(9-18)23-15/h3,6,8,10,12-15,18-20H,4-5,7,9H2,1-2H3.
What are the key properties of 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate?
3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate has a molecular weight of 327.38 g/mol, XLogP of 0.12, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl 1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4H-pyridine-3-carboxylate is sourced from PubChem (CID 135255372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).