C26H28ClF3N6O — CID 135255448
1-[4-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]-2-(trifluoromethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 135255448) has the molecular formula C26H28ClF3N6O and a molecular weight of 533.00 g/mol. Its IUPAC name is 1-[4-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]-2-(trifluoromethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]-2-(trifluoromethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 135255448 |
| Molecular Formula | C26H28ClF3N6O |
| Molecular Weight | 533.00 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | 1-[4-[(1S,3R)-3-[[5-chloro-4-(1H-indol-3-yl)pyrimidin-2-yl]amino]cyclohexyl]-2-(trifluoromethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN([C@H]2CCC[C@@H](Nc3ncc(Cl)c(-c4c[nH]c5ccccc45)n3)C2)CC1C(F)(F)F |
| InChI | InChI=1S/C26H28ClF3N6O/c1-2-23(37)36-11-10-35(15-22(36)26(28,29)30)17-7-5-6-16(12-17)33-25-32-14-20(27)24(34-25)19-13-31-21-9-4-3-8-18(19)21/h2-4,8-9,13-14,16-17,22,31H,1,5-7,10-12,15H2,(H,32,33,34)/t16-,17+,22?/m1/s1 |
| InChIKey | KFJVVEDDGRIBOT-KDPSSXBDSA-N |
| XLogP | 5.26 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.00 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|