About 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine
5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine (PubChem CID 135256256) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine.
Analyze 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine?
The IUPAC name of 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine (CID 135256256) is 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine.
What is the SMILES notation for 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine?
The canonical SMILES for 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine is Cc1cc(C)c2c(n1)CCN2.
What is the InChIKey of 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine?
The InChIKey is SJMDWNKSTKHOML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-6-5-7(2)11-8-3-4-10-9(6)8/h5,10H,3-4H2,1-2H3.
What are the key properties of 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine?
5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine has a molecular weight of 148.21 g/mol, XLogP of 1.67, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-2,3-dihydro-1H-pyrrolo[3,2-b]pyridine is sourced from PubChem (CID 135256256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).