About 4-heptyl-N,N-dimethylcyclohexan-1-amine
4-heptyl-N,N-dimethylcyclohexan-1-amine (PubChem CID 135256513) has the molecular formula C15H31N
and a molecular weight of 225.42 g/mol. Its IUPAC name is 4-heptyl-N,N-dimethylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 4-heptyl-N,N-dimethylcyclohexan-1-amine |
| PubChem CID | 135256513 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | 4-heptyl-N,N-dimethylcyclohexan-1-amine |
| SMILES | CCCCCCCC1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C15H31N/c1-4-5-6-7-8-9-14-10-12-15(13-11-14)16(2)3/h14-15H,4-13H2,1-3H3 |
| InChIKey | GYSPOJIMZIKCOY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-heptyl-N,N-dimethylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-heptyl-N,N-dimethylcyclohexan-1-amine?
The IUPAC name of 4-heptyl-N,N-dimethylcyclohexan-1-amine (CID 135256513) is 4-heptyl-N,N-dimethylcyclohexan-1-amine.
What is the SMILES notation for 4-heptyl-N,N-dimethylcyclohexan-1-amine?
The canonical SMILES for 4-heptyl-N,N-dimethylcyclohexan-1-amine is CCCCCCCC1CCC(N(C)C)CC1.
What is the InChIKey of 4-heptyl-N,N-dimethylcyclohexan-1-amine?
The InChIKey is GYSPOJIMZIKCOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31N/c1-4-5-6-7-8-9-14-10-12-15(13-11-14)16(2)3/h14-15H,4-13H2,1-3H3.
What are the key properties of 4-heptyl-N,N-dimethylcyclohexan-1-amine?
4-heptyl-N,N-dimethylcyclohexan-1-amine has a molecular weight of 225.42 g/mol, XLogP of 4.47, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-heptyl-N,N-dimethylcyclohexan-1-amine is sourced from PubChem (CID 135256513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).