About 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one
3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one (PubChem CID 135256945) has the molecular formula C13H19NO6
and a molecular weight of 285.30 g/mol. Its IUPAC name is 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one.
Molecular Properties
| Compound Name | 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one |
| PubChem CID | 135256945 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one |
| SMILES | Cc1c(OC2CC(O)C(O)C(CO)O2)c(=O)ccn1C |
| InChI | InChI=1S/C13H19NO6/c1-7-13(8(16)3-4-14(7)2)20-11-5-9(17)12(18)10(6-15)19-11/h3-4,9-12,15,17-18H,5-6H2,1-2H3 |
| InChIKey | LCJFRAQOIFOPHJ-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one?
The IUPAC name of 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one (CID 135256945) is 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one.
What is the SMILES notation for 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one?
The canonical SMILES for 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one is Cc1c(OC2CC(O)C(O)C(CO)O2)c(=O)ccn1C.
What is the InChIKey of 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one?
The InChIKey is LCJFRAQOIFOPHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO6/c1-7-13(8(16)3-4-14(7)2)20-11-5-9(17)12(18)10(6-15)19-11/h3-4,9-12,15,17-18H,5-6H2,1-2H3.
What are the key properties of 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one?
3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one has a molecular weight of 285.30 g/mol, XLogP of -1.10, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2-dimethylpyridin-4-one is sourced from PubChem (CID 135256945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).